C17H17N3O5 — CID 135460491
N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[(2-phenoxyacetyl)amino]acetamide (PubChem CID 135460491) has the molecular formula C17H17N3O5 and a molecular weight of 343.34 g/mol. Its IUPAC name is N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[(2-phenoxyacetyl)amino]acetamide.
| Compound Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[(2-phenoxyacetyl)amino]acetamide |
|---|---|
| PubChem CID | 135460491 |
| Molecular Formula | C17H17N3O5 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[(2-phenoxyacetyl)amino]acetamide |
| SMILES | O=C(COc1ccccc1)NCC(=O)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C17H17N3O5/c21-13-7-6-12(15(22)8-13)9-19-20-16(23)10-18-17(24)11-25-14-4-2-1-3-5-14/h1-9,21-22H,10-11H2,(H,18,24)(H,20,23)/b19-9+ |
| InChIKey | OWVRDNXXFQEPHI-DJKKODMXSA-N |
| XLogP | 0.74 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|