C18H19N3O5 — CID 135635740
N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[[2-(3-methylphenoxy)acetyl]amino]acetamide (PubChem CID 135635740) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[[2-(3-methylphenoxy)acetyl]amino]acetamide.
| Compound Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[[2-(3-methylphenoxy)acetyl]amino]acetamide |
|---|---|
| PubChem CID | 135635740 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-[[2-(3-methylphenoxy)acetyl]amino]acetamide |
| SMILES | Cc1cccc(OCC(=O)NCC(=O)N/N=C/c2ccc(O)cc2O)c1 |
| InChI | InChI=1S/C18H19N3O5/c1-12-3-2-4-15(7-12)26-11-18(25)19-10-17(24)21-20-9-13-5-6-14(22)8-16(13)23/h2-9,22-23H,10-11H2,1H3,(H,19,25)(H,21,24)/b20-9+ |
| InChIKey | BCQYODJBQLOHEE-AWQFTUOYSA-N |
| XLogP | 1.05 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|