C20H13N3O3 — CID 135460761
3-[2-hydroxy-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrol-3-yl]indol-2-one (PubChem CID 135460761) has the molecular formula C20H13N3O3 and a molecular weight of 347.31 g/mol. Its IUPAC name is 3-[2-hydroxy-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrol-3-yl]indol-2-one.
| Compound Name | 3-[2-hydroxy-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrol-3-yl]indol-2-one |
|---|---|
| PubChem CID | 135460761 |
| Molecular Formula | C20H13N3O3 |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-[2-hydroxy-5-(5-hydroxy-1H-indol-3-yl)-1H-pyrrol-3-yl]indol-2-one |
| SMILES | O=[13C]1N=c2ccccc2=[13C]1c1cc(-[13c]2[13cH][nH]c3ccc(O)cc32)[nH]c1O |
| InChI | InChI=1S/C20H13N3O3/c24-10-5-6-15-12(7-10)14(9-21-15)17-8-13(19(25)23-17)18-11-3-1-2-4-16(11)22-20(18)26/h1-9,21,23-25H/i9+1,14+1,18+1,20+1 |
| InChIKey | SHLJIZCPRXXHHZ-CIMBIPCJSA-N |
| XLogP | 1.93 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |