C14H11FN2O — CID 135461169
2-(2-fluorophenyl)-7,8-dihydro-3H-quinazolin-4-one (PubChem CID 135461169) has the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-7,8-dihydro-3H-quinazolin-4-one.
| Compound Name | 2-(2-fluorophenyl)-7,8-dihydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135461169 |
| Molecular Formula | C14H11FN2O |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-(2-fluorophenyl)-7,8-dihydro-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(-c2ccccc2F)nc2c1C=CCC2 |
| InChI | InChI=1S/C14H11FN2O/c15-11-7-3-1-5-9(11)13-16-12-8-4-2-6-10(12)14(18)17-13/h1-3,5-7H,4,8H2,(H,16,17,18) |
| InChIKey | NJTARLFSOZYTDM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |