C25H19N5O4S — CID 135463328
2-[3-(4-hydroxyphenyl)-4-oxo-2-[(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide (PubChem CID 135463328) has the molecular formula C25H19N5O4S and a molecular weight of 485.53 g/mol. Its IUPAC name is 2-[3-(4-hydroxyphenyl)-4-oxo-2-[(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide.
| Compound Name | 2-[3-(4-hydroxyphenyl)-4-oxo-2-[(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 135463328 |
| Molecular Formula | C25H19N5O4S |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 2-[3-(4-hydroxyphenyl)-4-oxo-2-[(2-oxo-1H-indol-3-ylidene)hydrazinylidene]-1,3-thiazolidin-5-yl]-N-phenylacetamide |
| SMILES | O=C(CC1SC(=NN=C2C(=O)Nc3ccccc32)N(c2ccc(O)cc2)C1=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H19N5O4S/c31-17-12-10-16(11-13-17)30-24(34)20(14-21(32)26-15-6-2-1-3-7-15)35-25(30)29-28-22-18-8-4-5-9-19(18)27-23(22)33/h1-13,20,31H,14H2,(H,26,32)(H,27,28,33) |
| InChIKey | RBHCWBVQLVBQNS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|