C8H10N2O3S — CID 135463590
methyl 4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 135463590) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is methyl 4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | methyl 4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 135463590 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | methyl 4-methyl-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | COC(=O)c1c(C)nc(SC)[nH]c1=O |
| InChI | InChI=1S/C8H10N2O3S/c1-4-5(7(12)13-2)6(11)10-8(9-4)14-3/h1-3H3,(H,9,10,11) |
| InChIKey | HQFZOIXHBDZPOZ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |