C22H28F3N3O3S — CID 135464720
6-octylsulfonyl-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 135464720) has the molecular formula C22H28F3N3O3S and a molecular weight of 471.55 g/mol. Its IUPAC name is 6-octylsulfonyl-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-octylsulfonyl-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135464720 |
| Molecular Formula | C22H28F3N3O3S |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 6-octylsulfonyl-2-[4-(trifluoromethyl)phenyl]-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | CCCCCCCCS(=O)(=O)N1CCc2nc(-c3ccc(C(F)(F)F)cc3)[nH]c(=O)c2C1 |
| InChI | InChI=1S/C22H28F3N3O3S/c1-2-3-4-5-6-7-14-32(30,31)28-13-12-19-18(15-28)21(29)27-20(26-19)16-8-10-17(11-9-16)22(23,24)25/h8-11H,2-7,12-15H2,1H3,(H,26,27,29) |
| InChIKey | DICTUSIZPQUWBF-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|