C18H23FN4O3S — CID 135892917
2-[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]phenyl]-5-fluoro-4-methyl-1H-pyrimidin-6-one (PubChem CID 135892917) has the molecular formula C18H23FN4O3S and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]phenyl]-5-fluoro-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]phenyl]-5-fluoro-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135892917 |
| Molecular Formula | C18H23FN4O3S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 2-[4-[(4-ethylsulfonylpiperazin-1-yl)methyl]phenyl]-5-fluoro-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCS(=O)(=O)N1CCN(Cc2ccc(-c3nc(C)c(F)c(=O)[nH]3)cc2)CC1 |
| InChI | InChI=1S/C18H23FN4O3S/c1-3-27(25,26)23-10-8-22(9-11-23)12-14-4-6-15(7-5-14)17-20-13(2)16(19)18(24)21-17/h4-7H,3,8-12H2,1-2H3,(H,20,21,24) |
| InChIKey | XMYKCHHLIXRYQR-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 86.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |