C22H22Cl2N2O2S — CID 135465422
4-[(2,6-dichlorophenyl)methyl]-2-[3-(4-methoxyphenyl)propylsulfanyl]-5-methyl-1H-pyrimidin-6-one (PubChem CID 135465422) has the molecular formula C22H22Cl2N2O2S and a molecular weight of 449.40 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyl]-2-[3-(4-methoxyphenyl)propylsulfanyl]-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(2,6-dichlorophenyl)methyl]-2-[3-(4-methoxyphenyl)propylsulfanyl]-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135465422 |
| Molecular Formula | C22H22Cl2N2O2S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyl]-2-[3-(4-methoxyphenyl)propylsulfanyl]-5-methyl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(CCCSc2nc(Cc3c(Cl)cccc3Cl)c(C)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O2S/c1-14-20(13-17-18(23)6-3-7-19(17)24)25-22(26-21(14)27)29-12-4-5-15-8-10-16(28-2)11-9-15/h3,6-11H,4-5,12-13H2,1-2H3,(H,25,26,27) |
| InChIKey | QBEYKJNAHQXCHY-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|