C22H22Cl2N2O3S — CID 135797318
4-[(2,6-dichlorophenyl)methyl]-2-[2-[(4-methoxyphenyl)methoxy]ethylsulfanyl]-5-methyl-1H-pyrimidin-6-one (PubChem CID 135797318) has the molecular formula C22H22Cl2N2O3S and a molecular weight of 465.40 g/mol. Its IUPAC name is 4-[(2,6-dichlorophenyl)methyl]-2-[2-[(4-methoxyphenyl)methoxy]ethylsulfanyl]-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[(2,6-dichlorophenyl)methyl]-2-[2-[(4-methoxyphenyl)methoxy]ethylsulfanyl]-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135797318 |
| Molecular Formula | C22H22Cl2N2O3S |
| Molecular Weight | 465.40 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 4-[(2,6-dichlorophenyl)methyl]-2-[2-[(4-methoxyphenyl)methoxy]ethylsulfanyl]-5-methyl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(COCCSc2nc(Cc3c(Cl)cccc3Cl)c(C)c(=O)[nH]2)cc1 |
| InChI | InChI=1S/C22H22Cl2N2O3S/c1-14-20(12-17-18(23)4-3-5-19(17)24)25-22(26-21(14)27)30-11-10-29-13-15-6-8-16(28-2)9-7-15/h3-9H,10-13H2,1-2H3,(H,25,26,27) |
| InChIKey | YEPKQWDTDDIEQL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|