C21H15ClN2OS — CID 135465465
(2'S,3S)-5-chloro-2'-[6-(2-sulfanylphenyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 135465465) has the molecular formula C21H15ClN2OS and a molecular weight of 378.88 g/mol. Its IUPAC name is (2'S,3S)-5-chloro-2'-[6-(2-sulfanylphenyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (2'S,3S)-5-chloro-2'-[6-(2-sulfanylphenyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 135465465 |
| Molecular Formula | C21H15ClN2OS |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | (2'S,3S)-5-chloro-2'-[6-(2-sulfanylphenyl)-2-pyridinyl]spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2[C@@]12C[C@@H]2c1cccc(-c2ccccc2S)n1 |
| InChI | InChI=1S/C21H15ClN2OS/c22-12-8-9-18-14(10-12)21(20(25)24-18)11-15(21)17-6-3-5-16(23-17)13-4-1-2-7-19(13)26/h1-10,15,26H,11H2,(H,24,25)/t15-,21-/m1/s1 |
| InChIKey | IVMFGLDLZXUIAG-QVKFZJNVSA-N |
| XLogP | 5.07 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|