C18H13ClN2O — CID 15956400
(2'S,3S)-5-chloro-2'-(6-prop-1-ynyl-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 15956400) has the molecular formula C18H13ClN2O and a molecular weight of 308.77 g/mol. Its IUPAC name is (2'S,3S)-5-chloro-2'-(6-prop-1-ynyl-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (2'S,3S)-5-chloro-2'-(6-prop-1-ynyl-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 15956400 |
| Molecular Formula | C18H13ClN2O |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | (2'S,3S)-5-chloro-2'-(6-prop-1-ynyl-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | CC#Cc1cccc([C@H]2C[C@]23C(=O)Nc2ccc(Cl)cc23)n1 |
| InChI | InChI=1S/C18H13ClN2O/c1-2-4-12-5-3-6-15(20-12)14-10-18(14)13-9-11(19)7-8-16(13)21-17(18)22/h3,5-9,14H,10H2,1H3,(H,21,22)/t14-,18-/m1/s1 |
| InChIKey | JAOGFQRDDBPUJT-RDTXWAMCSA-N |
| XLogP | 3.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|