C17H14ClN3O3 — CID 15956391
(2'S,3S)-5-chloro-2'-(3,5-dimethyl-4-nitro-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 15956391) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is (2'S,3S)-5-chloro-2'-(3,5-dimethyl-4-nitro-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (2'S,3S)-5-chloro-2'-(3,5-dimethyl-4-nitro-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 15956391 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (2'S,3S)-5-chloro-2'-(3,5-dimethyl-4-nitro-2-pyridinyl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | Cc1cnc([C@H]2C[C@]23C(=O)Nc2ccc(Cl)cc23)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14ClN3O3/c1-8-7-19-14(9(2)15(8)21(23)24)12-6-17(12)11-5-10(18)3-4-13(11)20-16(17)22/h3-5,7,12H,6H2,1-2H3,(H,20,22)/t12-,17-/m1/s1 |
| InChIKey | DDFMYQBIQBWTSN-SJKOYZFVSA-N |
| XLogP | 3.64 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|