C19H20N2O — CID 135465496
4,5-dimethyl-2-[4-methyl-1-(2-methylphenyl)pyrazol-5-yl]phenol (PubChem CID 135465496) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 4,5-dimethyl-2-[4-methyl-1-(2-methylphenyl)pyrazol-5-yl]phenol.
| Compound Name | 4,5-dimethyl-2-[4-methyl-1-(2-methylphenyl)pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 135465496 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 4,5-dimethyl-2-[4-methyl-1-(2-methylphenyl)pyrazol-5-yl]phenol |
| SMILES | Cc1cc(O)c(-c2c(C)cnn2-c2ccccc2C)cc1C |
| InChI | InChI=1S/C19H20N2O/c1-12-7-5-6-8-17(12)21-19(15(4)11-20-21)16-9-13(2)14(3)10-18(16)22/h5-11,22H,1-4H3 |
| InChIKey | UDNLXDZFOPCGGD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |