C22H21N5O — CID 135465614
N-(2-anilinoethyl)-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole-7-carboxamide (PubChem CID 135465614) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is N-(2-anilinoethyl)-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole-7-carboxamide.
| Compound Name | N-(2-anilinoethyl)-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole-7-carboxamide |
|---|---|
| PubChem CID | 135465614 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-(2-anilinoethyl)-1,4,5,10-tetrahydropyrazolo[5,4-a]carbazole-7-carboxamide |
| SMILES | O=C(NCCNc1ccccc1)c1ccc2[nH]c3c(c2c1)CCc1cn[nH]c1-3 |
| InChI | InChI=1S/C22H21N5O/c28-22(24-11-10-23-16-4-2-1-3-5-16)14-7-9-19-18(12-14)17-8-6-15-13-25-27-20(15)21(17)26-19/h1-5,7,9,12-13,23,26H,6,8,10-11H2,(H,24,28)(H,25,27) |
| InChIKey | PXRZCQREISXWGN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|