C26H25FN4O2 — CID 135505818
[4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-(3,4,17-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-13-yl)methanone (PubChem CID 135505818) has the molecular formula C26H25FN4O2 and a molecular weight of 444.51 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-(3,4,17-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-13-yl)methanone.
| Compound Name | [4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-(3,4,17-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-13-yl)methanone |
|---|---|
| PubChem CID | 135505818 |
| Molecular Formula | C26H25FN4O2 |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | [4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-(3,4,17-triazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),2(6),4,11(16),12,14-hexaen-13-yl)methanone |
| SMILES | O=C(c1ccc2[nH]c3c(c2c1)CCCc1cn[nH]c1-3)N1CCC(O)(c2ccccc2F)CC1 |
| InChI | InChI=1S/C26H25FN4O2/c27-21-7-2-1-6-20(21)26(33)10-12-31(13-11-26)25(32)16-8-9-22-19(14-16)18-5-3-4-17-15-28-30-23(17)24(18)29-22/h1-2,6-9,14-15,29,33H,3-5,10-13H2,(H,28,30) |
| InChIKey | RVBJBOOPEOUTED-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|