C19H18FN3O2S — CID 51036130
[4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-[5-(1H-pyrazol-4-yl)thiophen-3-yl]methanone (PubChem CID 51036130) has the molecular formula C19H18FN3O2S and a molecular weight of 371.44 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-[5-(1H-pyrazol-4-yl)thiophen-3-yl]methanone.
| Compound Name | [4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-[5-(1H-pyrazol-4-yl)thiophen-3-yl]methanone |
|---|---|
| PubChem CID | 51036130 |
| Molecular Formula | C19H18FN3O2S |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [4-(2-fluorophenyl)-4-hydroxypiperidin-1-yl]-[5-(1H-pyrazol-4-yl)thiophen-3-yl]methanone |
| SMILES | O=C(c1csc(-c2cn[nH]c2)c1)N1CCC(O)(c2ccccc2F)CC1 |
| InChI | InChI=1S/C19H18FN3O2S/c20-16-4-2-1-3-15(16)19(25)5-7-23(8-6-19)18(24)13-9-17(26-12-13)14-10-21-22-11-14/h1-4,9-12,25H,5-8H2,(H,21,22) |
| InChIKey | GPGXALJIEIOSPM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |