C10H8F2N4O — CID 135465852
2-amino-4-(3,4-difluoroanilino)-1H-pyrimidin-6-one (PubChem CID 135465852) has the molecular formula C10H8F2N4O and a molecular weight of 238.20 g/mol. Its IUPAC name is 2-amino-4-(3,4-difluoroanilino)-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-(3,4-difluoroanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135465852 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 2-amino-4-(3,4-difluoroanilino)-1H-pyrimidin-6-one |
| SMILES | Nc1nc(Nc2ccc(F)c(F)c2)cc(=O)[nH]1 |
| InChI | InChI=1S/C10H8F2N4O/c11-6-2-1-5(3-7(6)12)14-8-4-9(17)16-10(13)15-8/h1-4H,(H4,13,14,15,16,17) |
| InChIKey | KUTSIRBIGZNIFG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |