C19H16N2O4 — CID 135468035
(2E)-2-(2-ethoxy-2-oxo-1-pyridin-1-ium-1-ylethylidene)-6-phenyl-1,3-oxazin-4-olate (PubChem CID 135468035) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (2E)-2-(2-ethoxy-2-oxo-1-pyridin-1-ium-1-ylethylidene)-6-phenyl-1,3-oxazin-4-olate.
| Compound Name | (2E)-2-(2-ethoxy-2-oxo-1-pyridin-1-ium-1-ylethylidene)-6-phenyl-1,3-oxazin-4-olate |
|---|---|
| PubChem CID | 135468035 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | (2E)-2-(2-ethoxy-2-oxo-1-pyridin-1-ium-1-ylethylidene)-6-phenyl-1,3-oxazin-4-olate |
| SMILES | CCOC(=O)/C(=C1/N=C([O-])C=C(c2ccccc2)O1)[n+]1ccccc1 |
| InChI | InChI=1S/C19H16N2O4/c1-2-24-19(23)17(21-11-7-4-8-12-21)18-20-16(22)13-15(25-18)14-9-5-3-6-10-14/h3-13H,2H2,1H3 |
| InChIKey | BOWWGZGMQIBEMM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 74.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|