C16H19N3O3S — CID 135468506
pentyl 2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetate (PubChem CID 135468506) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is pentyl 2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetate.
| Compound Name | pentyl 2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 135468506 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | pentyl 2-[(5-oxo-6-phenyl-4H-1,2,4-triazin-3-yl)sulfanyl]acetate |
| SMILES | CCCCCOC(=O)CSc1nnc(-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H19N3O3S/c1-2-3-7-10-22-13(20)11-23-16-17-15(21)14(18-19-16)12-8-5-4-6-9-12/h4-6,8-9H,2-3,7,10-11H2,1H3,(H,17,19,21) |
| InChIKey | XRZYGGNAQAJSHE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|