C16H16FN3O4S — CID 141454212
ethyl 4-[[6-[(4-fluorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-3-oxobutanoate (PubChem CID 141454212) has the molecular formula C16H16FN3O4S and a molecular weight of 365.39 g/mol. Its IUPAC name is ethyl 4-[[6-[(4-fluorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 4-[[6-[(4-fluorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 141454212 |
| Molecular Formula | C16H16FN3O4S |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.08 |
| IUPAC Name | ethyl 4-[[6-[(4-fluorophenyl)methyl]-5-oxo-4H-1,2,4-triazin-3-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CSc1nnc(Cc2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H16FN3O4S/c1-2-24-14(22)8-12(21)9-25-16-18-15(23)13(19-20-16)7-10-3-5-11(17)6-4-10/h3-6H,2,7-9H2,1H3,(H,18,20,23) |
| InChIKey | NXURTOHEWYWUJT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|