C18H18IN5O — CID 135469405
2-[2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 135469405) has the molecular formula C18H18IN5O and a molecular weight of 447.28 g/mol. Its IUPAC name is 2-[2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135469405 |
| Molecular Formula | C18H18IN5O |
| Molecular Weight | 447.28 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 2-[2-[[1-(4-iodophenyl)-2,5-dimethylpyrrol-3-yl]methylidene]hydrazinyl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(NN=Cc2cc(C)n(-c3ccc(I)cc3)c2C)n1 |
| InChI | InChI=1S/C18H18IN5O/c1-11-8-17(25)22-18(21-11)23-20-10-14-9-12(2)24(13(14)3)16-6-4-15(19)5-7-16/h4-10H,1-3H3,(H2,21,22,23,25) |
| InChIKey | NRDCCSGWCWKDRV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.28 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|