C19H16N4O8S2 — CID 135470627
2-[(2E)-2-[(E)-[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid (PubChem CID 135470627) has the molecular formula C19H16N4O8S2 and a molecular weight of 492.49 g/mol. Its IUPAC name is 2-[(2E)-2-[(E)-[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid.
| Compound Name | 2-[(2E)-2-[(E)-[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
|---|---|
| PubChem CID | 135470627 |
| Molecular Formula | C19H16N4O8S2 |
| Molecular Weight | 492.49 g/mol |
| Exact Mass | 492.04 |
| IUPAC Name | 2-[(2E)-2-[(E)-[4-(4-methyl-3-nitrophenyl)sulfonyloxyphenyl]methylidenehydrazinylidene]-4-oxo-1,3-thiazolidin-5-yl]acetic acid |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(/C=N/N=C3\NC(=O)C(CC(=O)O)S3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H16N4O8S2/c1-11-2-7-14(8-15(11)23(27)28)33(29,30)31-13-5-3-12(4-6-13)10-20-22-19-21-18(26)16(32-19)9-17(24)25/h2-8,10,16H,9H2,1H3,(H,24,25)(H,21,22,26)/b20-10+ |
| InChIKey | QZPRWSHXYJBSCG-KEBDBYFISA-N |
| XLogP | 2.07 |
| TPSA | 177.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.49 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|