C15H16N4O3 — CID 135470924
2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide (PubChem CID 135470924) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide.
| Compound Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135470924 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 2-(2,4-dimethyl-6-oxo-1H-pyrimidin-5-yl)-N-[(E)-(4-hydroxyphenyl)methylideneamino]acetamide |
| SMILES | Cc1nc(C)c(CC(=O)N/N=C/c2ccc(O)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H16N4O3/c1-9-13(15(22)18-10(2)17-9)7-14(21)19-16-8-11-3-5-12(20)6-4-11/h3-6,8,20H,7H2,1-2H3,(H,19,21)(H,17,18,22)/b16-8+ |
| InChIKey | RJWAHTZLXVLMQI-LZYBPNLTSA-N |
| XLogP | 0.79 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|