C20H14N2O — CID 135471735
2-(2-naphthalen-1-ylethenyl)-3H-quinazolin-4-one (PubChem CID 135471735) has the molecular formula C20H14N2O and a molecular weight of 298.35 g/mol. Its IUPAC name is 2-(2-naphthalen-1-ylethenyl)-3H-quinazolin-4-one.
| Compound Name | 2-(2-naphthalen-1-ylethenyl)-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135471735 |
| Molecular Formula | C20H14N2O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(2-naphthalen-1-ylethenyl)-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(C=Cc2cccc3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C20H14N2O/c23-20-17-10-3-4-11-18(17)21-19(22-20)13-12-15-8-5-7-14-6-1-2-9-16(14)15/h1-13H,(H,21,22,23) |
| InChIKey | LSBSXEMERYPADA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |