C16H11BrN2O2 — CID 135514039
2-[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one (PubChem CID 135514039) has the molecular formula C16H11BrN2O2 and a molecular weight of 343.18 g/mol. Its IUPAC name is 2-[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135514039 |
| Molecular Formula | C16H11BrN2O2 |
| Molecular Weight | 343.18 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 2-[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(/C=C/c2cc(Br)ccc2O)nc2ccccc12 |
| InChI | InChI=1S/C16H11BrN2O2/c17-11-6-7-14(20)10(9-11)5-8-15-18-13-4-2-1-3-12(13)16(21)19-15/h1-9,20H,(H,18,19,21)/b8-5+ |
| InChIKey | DCKGDPBQJCLLFT-VMPITWQZSA-N |
| XLogP | 3.56 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |