C18H15BrN4O3S — CID 135615878
N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide (PubChem CID 135615878) has the molecular formula C18H15BrN4O3S and a molecular weight of 447.31 g/mol. Its IUPAC name is N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide.
| Compound Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 135615878 |
| Molecular Formula | C18H15BrN4O3S |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.00 |
| IUPAC Name | N-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[(4-oxo-3H-quinazolin-2-yl)sulfanyl]propanamide |
| SMILES | CC(Sc1nc2ccccc2c(=O)[nH]1)C(=O)N/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C18H15BrN4O3S/c1-10(16(25)23-20-9-11-8-12(19)6-7-15(11)24)27-18-21-14-5-3-2-4-13(14)17(26)22-18/h2-10,24H,1H3,(H,23,25)(H,21,22,26)/b20-9+ |
| InChIKey | FPQGWPZNLIHPDQ-AWQFTUOYSA-N |
| XLogP | 3.02 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|