C40H48N6O2Zn — CID 135471925
zinc bis(3-methoxy-2-[(5-methyl-4-pentylpyrrol-1-id-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole) (PubChem CID 135471925) has the molecular formula C40H48N6O2Zn and a molecular weight of 710.25 g/mol. Its IUPAC name is zinc bis(3-methoxy-2-[(5-methyl-4-pentylpyrrol-1-id-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole).
| Compound Name | zinc bis(3-methoxy-2-[(5-methyl-4-pentylpyrrol-1-id-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole) |
|---|---|
| PubChem CID | 135471925 |
| Molecular Formula | C40H48N6O2Zn |
| Molecular Weight | 710.25 g/mol |
| Exact Mass | 708.31 |
| IUPAC Name | zinc bis(3-methoxy-2-[(5-methyl-4-pentylpyrrol-1-id-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole) |
| SMILES | CCCCCc1cc(C=C2N=C(c3ccc[nH]3)C=C2OC)[n-]c1C.CCCCCc1cc(C=C2N=C(c3ccc[nH]3)C=C2OC)[n-]c1C.[Zn+2] |
| InChI | InChI=1S/2C20H24N3O.Zn/c2*1-4-5-6-8-15-11-16(22-14(15)2)12-19-20(24-3)13-18(23-19)17-9-7-10-21-17;/h2*7,9-13,21H,4-6,8H2,1-3H3;/q2*-1;+2 |
| InChIKey | LAXMSBFEGQKEDR-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.25 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|