C20H25N3O — CID 169445856
2,3,4-trideuterio-5-[4-methoxy-5-[(5-methyl-4-pentyl-1H-pyrrol-2-yl)methylidene]pyrrol-2-yl]-1H-pyrrole (PubChem CID 169445856) has the molecular formula C20H25N3O and a molecular weight of 326.46 g/mol. Its IUPAC name is 2,3,4-trideuterio-5-[4-methoxy-5-[(5-methyl-4-pentyl-1H-pyrrol-2-yl)methylidene]pyrrol-2-yl]-1H-pyrrole.
| Compound Name | 2,3,4-trideuterio-5-[4-methoxy-5-[(5-methyl-4-pentyl-1H-pyrrol-2-yl)methylidene]pyrrol-2-yl]-1H-pyrrole |
|---|---|
| PubChem CID | 169445856 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2,3,4-trideuterio-5-[4-methoxy-5-[(5-methyl-4-pentyl-1H-pyrrol-2-yl)methylidene]pyrrol-2-yl]-1H-pyrrole |
| SMILES | [2H]c1[nH]c(C2=NC(=Cc3cc(CCCCC)c(C)[nH]3)C(OC)=C2)c([2H])c1[2H] |
| InChI | InChI=1S/C20H25N3O/c1-4-5-6-8-15-11-16(22-14(15)2)12-19-20(24-3)13-18(23-19)17-9-7-10-21-17/h7,9-13,21-22H,4-6,8H2,1-3H3/i7D,9D,10D |
| InChIKey | SHUNBVWMKSXXOM-WUVVEJKKSA-N |
| XLogP | 4.76 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|