C26H38ClN3O — CID 70136775
2-[(5-decyl-1H-pyrrol-2-yl)methylidene]-3-ethoxy-5-(5-methyl-1H-pyrrol-2-yl)pyrrole;hydrochloride (PubChem CID 70136775) has the molecular formula C26H38ClN3O and a molecular weight of 444.06 g/mol. Its IUPAC name is 2-[(5-decyl-1H-pyrrol-2-yl)methylidene]-3-ethoxy-5-(5-methyl-1H-pyrrol-2-yl)pyrrole;hydrochloride.
| Compound Name | 2-[(5-decyl-1H-pyrrol-2-yl)methylidene]-3-ethoxy-5-(5-methyl-1H-pyrrol-2-yl)pyrrole;hydrochloride |
|---|---|
| PubChem CID | 70136775 |
| Molecular Formula | C26H38ClN3O |
| Molecular Weight | 444.06 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 2-[(5-decyl-1H-pyrrol-2-yl)methylidene]-3-ethoxy-5-(5-methyl-1H-pyrrol-2-yl)pyrrole;hydrochloride |
| SMILES | CCCCCCCCCCc1ccc(C=C2N=C(c3ccc(C)[nH]3)C=C2OCC)[nH]1.Cl |
| InChI | InChI=1S/C26H37N3O.ClH/c1-4-6-7-8-9-10-11-12-13-21-15-16-22(28-21)18-25-26(30-5-2)19-24(29-25)23-17-14-20(3)27-23;/h14-19,27-28H,4-13H2,1-3H3;1H |
| InChIKey | OYJWDIQLRDMDGJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.06 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|