C24H33N3 — CID 145180858
(2Z)-4-ethyl-3-methyl-2-[(5-octyl-1H-pyrrol-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole (PubChem CID 145180858) has the molecular formula C24H33N3 and a molecular weight of 363.55 g/mol. Its IUPAC name is (2Z)-4-ethyl-3-methyl-2-[(5-octyl-1H-pyrrol-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole.
| Compound Name | (2Z)-4-ethyl-3-methyl-2-[(5-octyl-1H-pyrrol-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole |
|---|---|
| PubChem CID | 145180858 |
| Molecular Formula | C24H33N3 |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.27 |
| IUPAC Name | (2Z)-4-ethyl-3-methyl-2-[(5-octyl-1H-pyrrol-2-yl)methylidene]-5-(1H-pyrrol-2-yl)pyrrole |
| SMILES | CCCCCCCCc1ccc(/C=C2\N=C(c3ccc[nH]3)C(CC)=C2C)[nH]1 |
| InChI | InChI=1S/C24H33N3/c1-4-6-7-8-9-10-12-19-14-15-20(26-19)17-23-18(3)21(5-2)24(27-23)22-13-11-16-25-22/h11,13-17,25-26H,4-10,12H2,1-3H3/b23-17- |
| InChIKey | KVCQYUCVJGBXJN-QJOMJCCJSA-N |
| XLogP | 6.82 |
| TPSA | 43.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|