C27H31N3O2 — CID 152780873
2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-3-propoxy-5-(1H-pyrrol-2-yl)pyrrole (PubChem CID 152780873) has the molecular formula C27H31N3O2 and a molecular weight of 429.56 g/mol. Its IUPAC name is 2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-3-propoxy-5-(1H-pyrrol-2-yl)pyrrole.
| Compound Name | 2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-3-propoxy-5-(1H-pyrrol-2-yl)pyrrole |
|---|---|
| PubChem CID | 152780873 |
| Molecular Formula | C27H31N3O2 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-3-propoxy-5-(1H-pyrrol-2-yl)pyrrole |
| SMILES | CCCOC1=CC(c2ccc[nH]2)=NC1=Cc1ccc(CCCCCOc2ccccc2)[nH]1 |
| InChI | InChI=1S/C27H31N3O2/c1-2-17-32-27-20-25(24-13-9-16-28-24)30-26(27)19-22-15-14-21(29-22)10-5-4-8-18-31-23-11-6-3-7-12-23/h3,6-7,9,11-16,19-20,28-29H,2,4-5,8,10,17-18H2,1H3 |
| InChIKey | UNFXABMUWLXIGA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|