C25H28ClN3O2 — CID 172851640
3-methoxy-2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole;hydrochloride (PubChem CID 172851640) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is 3-methoxy-2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole;hydrochloride.
| Compound Name | 3-methoxy-2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole;hydrochloride |
|---|---|
| PubChem CID | 172851640 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 3-methoxy-2-[[5-(5-phenoxypentyl)-1H-pyrrol-2-yl]methylidene]-5-(1H-pyrrol-2-yl)pyrrole;hydrochloride |
| SMILES | COC1=CC(c2ccc[nH]2)=NC1=Cc1ccc(CCCCCOc2ccccc2)[nH]1.Cl |
| InChI | InChI=1S/C25H27N3O2.ClH/c1-29-25-18-23(22-12-8-15-26-22)28-24(25)17-20-14-13-19(27-20)9-4-3-7-16-30-21-10-5-2-6-11-21;/h2,5-6,8,10-15,17-18,26-27H,3-4,7,9,16H2,1H3;1H |
| InChIKey | QCFKMARMHSNLKD-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|