C19H14N4 — CID 135472716
2,5-diphenyl-3H-pyrido[3,2-e][1,2,4]triazepine (PubChem CID 135472716) has the molecular formula C19H14N4 and a molecular weight of 298.35 g/mol. Its IUPAC name is 2,5-diphenyl-3H-pyrido[3,2-e][1,2,4]triazepine.
| Compound Name | 2,5-diphenyl-3H-pyrido[3,2-e][1,2,4]triazepine |
|---|---|
| PubChem CID | 135472716 |
| Molecular Formula | C19H14N4 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2,5-diphenyl-3H-pyrido[3,2-e][1,2,4]triazepine |
| SMILES | c1ccc(C2=Nc3cccnc3C(c3ccccc3)=NN2)cc1 |
| InChI | InChI=1S/C19H14N4/c1-3-8-14(9-4-1)17-18-16(12-7-13-20-18)21-19(23-22-17)15-10-5-2-6-11-15/h1-13H,(H,21,23) |
| InChIKey | SQXRRTYAKPUDDX-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |