C16H22N4OS — CID 135472747
6-(2-aminophenyl)-3-heptylsulfanyl-4H-1,2,4-triazin-5-one (PubChem CID 135472747) has the molecular formula C16H22N4OS and a molecular weight of 318.45 g/mol. Its IUPAC name is 6-(2-aminophenyl)-3-heptylsulfanyl-4H-1,2,4-triazin-5-one.
| Compound Name | 6-(2-aminophenyl)-3-heptylsulfanyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135472747 |
| Molecular Formula | C16H22N4OS |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 6-(2-aminophenyl)-3-heptylsulfanyl-4H-1,2,4-triazin-5-one |
| SMILES | CCCCCCCSc1nnc(-c2ccccc2N)c(=O)[nH]1 |
| InChI | InChI=1S/C16H22N4OS/c1-2-3-4-5-8-11-22-16-18-15(21)14(19-20-16)12-9-6-7-10-13(12)17/h6-7,9-10H,2-5,8,11,17H2,1H3,(H,18,20,21) |
| InChIKey | HTEVUIFIPQXZPI-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|