C18H19ClN2O — CID 135472794
2-(3,4-dimethylanilino)-4-methylquinolin-5-ol;hydrochloride (PubChem CID 135472794) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-(3,4-dimethylanilino)-4-methylquinolin-5-ol;hydrochloride.
| Compound Name | 2-(3,4-dimethylanilino)-4-methylquinolin-5-ol;hydrochloride |
|---|---|
| PubChem CID | 135472794 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(3,4-dimethylanilino)-4-methylquinolin-5-ol;hydrochloride |
| SMILES | Cc1ccc(Nc2cc(C)c3c(O)cccc3n2)cc1C.Cl |
| InChI | InChI=1S/C18H18N2O.ClH/c1-11-7-8-14(9-12(11)2)19-17-10-13(3)18-15(20-17)5-4-6-16(18)21;/h4-10,21H,1-3H3,(H,19,20);1H |
| InChIKey | UEWIQVJYGPCFMI-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |