C16H15Cl2N3OS — CID 135472958
1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(1-phenylethyl)thiourea (PubChem CID 135472958) has the molecular formula C16H15Cl2N3OS and a molecular weight of 368.29 g/mol. Its IUPAC name is 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(1-phenylethyl)thiourea.
| Compound Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 135472958 |
| Molecular Formula | C16H15Cl2N3OS |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.03 |
| IUPAC Name | 1-[(E)-(3,5-dichloro-2-hydroxyphenyl)methylideneamino]-3-(1-phenylethyl)thiourea |
| SMILES | CC(NC(=S)N/N=C/c1cc(Cl)cc(Cl)c1O)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl2N3OS/c1-10(11-5-3-2-4-6-11)20-16(23)21-19-9-12-7-13(17)8-14(18)15(12)22/h2-10,22H,1H3,(H2,20,21,23)/b19-9+ |
| InChIKey | PVWQTWSDPZBROQ-DJKKODMXSA-N |
| XLogP | 4.26 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|