C15H22N2O2S — CID 135473132
2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-methyl-5-(2-methylprop-2-enyl)-1H-pyrimidin-6-one (PubChem CID 135473132) has the molecular formula C15H22N2O2S and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-methyl-5-(2-methylprop-2-enyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-methyl-5-(2-methylprop-2-enyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135473132 |
| Molecular Formula | C15H22N2O2S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-methyl-5-(2-methylprop-2-enyl)-1H-pyrimidin-6-one |
| SMILES | C=C(C)Cc1c(C)nc(SCC(=O)C(C)(C)C)[nH]c1=O |
| InChI | InChI=1S/C15H22N2O2S/c1-9(2)7-11-10(3)16-14(17-13(11)19)20-8-12(18)15(4,5)6/h1,7-8H2,2-6H3,(H,16,17,19) |
| InChIKey | SEFNZQKYVPQHHS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|