C9H13ClN2OS — CID 171987108
5-(2-chloroethyl)-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one (PubChem CID 171987108) has the molecular formula C9H13ClN2OS and a molecular weight of 232.74 g/mol. Its IUPAC name is 5-(2-chloroethyl)-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 5-(2-chloroethyl)-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 171987108 |
| Molecular Formula | C9H13ClN2OS |
| Molecular Weight | 232.74 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 5-(2-chloroethyl)-2-ethylsulfanyl-4-methyl-1H-pyrimidin-6-one |
| SMILES | CCSc1nc(C)c(CCCl)c(=O)[nH]1 |
| InChI | InChI=1S/C9H13ClN2OS/c1-3-14-9-11-6(2)7(4-5-10)8(13)12-9/h3-5H2,1-2H3,(H,11,12,13) |
| InChIKey | PDDGVJAFBQNERT-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.74 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|