C9H10N2OS2 — CID 156597537
2-ethylsulfanyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 156597537) has the molecular formula C9H10N2OS2 and a molecular weight of 226.33 g/mol. Its IUPAC name is 2-ethylsulfanyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-ethylsulfanyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 156597537 |
| Molecular Formula | C9H10N2OS2 |
| Molecular Weight | 226.33 g/mol |
| Exact Mass | 226.02 |
| IUPAC Name | 2-ethylsulfanyl-5-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCSc1nc2scc(C)c2c(=O)[nH]1 |
| InChI | InChI=1S/C9H10N2OS2/c1-3-13-9-10-7(12)6-5(2)4-14-8(6)11-9/h4H,3H2,1-2H3,(H,10,11,12) |
| InChIKey | QOOQGCBDPXKMER-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |