C7H5BrN2OS2 — CID 73012839
5-bromo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 73012839) has the molecular formula C7H5BrN2OS2 and a molecular weight of 277.17 g/mol. Its IUPAC name is 5-bromo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-bromo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 73012839 |
| Molecular Formula | C7H5BrN2OS2 |
| Molecular Weight | 277.17 g/mol |
| Exact Mass | 275.90 |
| IUPAC Name | 5-bromo-2-methylsulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CSc1nc2scc(Br)c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H5BrN2OS2/c1-12-7-9-5(11)4-3(8)2-13-6(4)10-7/h2H,1H3,(H,9,10,11) |
| InChIKey | HCUPIPSJEDIFLH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.17 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |