C9H12N4O3S — CID 145022040
ethane;2-methylsulfanyl-5,8-dihydro-3H-pteridine-4,6,7-trione (PubChem CID 145022040) has the molecular formula C9H12N4O3S and a molecular weight of 256.29 g/mol. Its IUPAC name is ethane;2-methylsulfanyl-5,8-dihydro-3H-pteridine-4,6,7-trione.
| Compound Name | ethane;2-methylsulfanyl-5,8-dihydro-3H-pteridine-4,6,7-trione |
|---|---|
| PubChem CID | 145022040 |
| Molecular Formula | C9H12N4O3S |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | ethane;2-methylsulfanyl-5,8-dihydro-3H-pteridine-4,6,7-trione |
| SMILES | CC.CSc1nc2[nH]c(=O)c(=O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C7H6N4O3S.C2H6/c1-15-7-10-3-2(4(12)11-7)8-5(13)6(14)9-3;1-2/h1H3,(H,8,13)(H2,9,10,11,12,14);1-2H3 |
| InChIKey | SCEXXAMFGDQJGD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|