C14H10N2OS2 — CID 45379647
5-methylsulfanyl-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-3-one (PubChem CID 45379647) has the molecular formula C14H10N2OS2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 5-methylsulfanyl-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-3-one.
| Compound Name | 5-methylsulfanyl-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-3-one |
|---|---|
| PubChem CID | 45379647 |
| Molecular Formula | C14H10N2OS2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | 5-methylsulfanyl-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-3-one |
| SMILES | CSc1nc2sc3c(c2c(=O)[nH]1)-c1ccccc1C3 |
| InChI | InChI=1S/C14H10N2OS2/c1-18-14-15-12(17)11-10-8-5-3-2-4-7(8)6-9(10)19-13(11)16-14/h2-5H,6H2,1H3,(H,15,16,17) |
| InChIKey | JPKQYNCFNIPEKE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |