C15H12N4O2S2 — CID 45379745
2-[(3-oxo-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-5-yl)sulfanyl]acetohydrazide (PubChem CID 45379745) has the molecular formula C15H12N4O2S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 2-[(3-oxo-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-5-yl)sulfanyl]acetohydrazide.
| Compound Name | 2-[(3-oxo-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-5-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 45379745 |
| Molecular Formula | C15H12N4O2S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.04 |
| IUPAC Name | 2-[(3-oxo-8-thia-4,6-diazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),5,11,13,15-hexaen-5-yl)sulfanyl]acetohydrazide |
| SMILES | NNC(=O)CSc1nc2sc3c(c2c(=O)[nH]1)-c1ccccc1C3 |
| InChI | InChI=1S/C15H12N4O2S2/c16-19-10(20)6-22-15-17-13(21)12-11-8-4-2-1-3-7(8)5-9(11)23-14(12)18-15/h1-4H,5-6,16H2,(H,19,20)(H,17,18,21) |
| InChIKey | KRTMFKYRGPSOKP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|