C13H10N4O2 — CID 135473443
6-(4-methoxyphenyl)-3H-pteridin-4-one (PubChem CID 135473443) has the molecular formula C13H10N4O2 and a molecular weight of 254.25 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-3H-pteridin-4-one.
| Compound Name | 6-(4-methoxyphenyl)-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135473443 |
| Molecular Formula | C13H10N4O2 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 6-(4-methoxyphenyl)-3H-pteridin-4-one |
| SMILES | COc1ccc(-c2cnc3nc[nH]c(=O)c3n2)cc1 |
| InChI | InChI=1S/C13H10N4O2/c1-19-9-4-2-8(3-5-9)10-6-14-12-11(17-10)13(18)16-7-15-12/h2-7H,1H3,(H,14,15,16,18) |
| InChIKey | XBLJKEBOGZCRSS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |