About 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione
6-acetyl-5,8-dihydroxynaphthalene-1,4-dione (PubChem CID 135475554) has the molecular formula C12H8O5
and a molecular weight of 232.19 g/mol. Its IUPAC name is 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione |
| PubChem CID | 135475554 |
| Molecular Formula | C12H8O5 |
| Molecular Weight | 232.19 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione |
| SMILES | CC(=O)c1cc(O)c2c(c1O)C(=O)C=CC2=O |
| InChI | InChI=1S/C12H8O5/c1-5(13)6-4-9(16)10-7(14)2-3-8(15)11(10)12(6)17/h2-4,16-17H,1H3 |
| InChIKey | UKVTXGBYZDOGSW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.19 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione?
The IUPAC name of 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione (CID 135475554) is 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione.
What is the SMILES notation for 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione?
The canonical SMILES for 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione is CC(=O)c1cc(O)c2c(c1O)C(=O)C=CC2=O.
What is the InChIKey of 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione?
The InChIKey is UKVTXGBYZDOGSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O5/c1-5(13)6-4-9(16)10-7(14)2-3-8(15)11(10)12(6)17/h2-4,16-17H,1H3.
What are the key properties of 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione?
6-acetyl-5,8-dihydroxynaphthalene-1,4-dione has a molecular weight of 232.19 g/mol, XLogP of 1.24, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-acetyl-5,8-dihydroxynaphthalene-1,4-dione is sourced from PubChem (CID 135475554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).