C22H24N4O5 — CID 135476250
4-[[1-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)piperidin-4-yl]amino]benzoic acid (PubChem CID 135476250) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is 4-[[1-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)piperidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[1-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)piperidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 135476250 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 4-[[1-(6,7-dimethoxy-4-oxo-3H-quinazolin-2-yl)piperidin-4-yl]amino]benzoic acid |
| SMILES | COc1cc2nc(N3CCC(Nc4ccc(C(=O)O)cc4)CC3)[nH]c(=O)c2cc1OC |
| InChI | InChI=1S/C22H24N4O5/c1-30-18-11-16-17(12-19(18)31-2)24-22(25-20(16)27)26-9-7-15(8-10-26)23-14-5-3-13(4-6-14)21(28)29/h3-6,11-12,15,23H,7-10H2,1-2H3,(H,28,29)(H,24,25,27) |
| InChIKey | ABMZURMMHLEPDD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 116.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |