C15H14N2O3 — CID 135478301
N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-phenylacetamide (PubChem CID 135478301) has the molecular formula C15H14N2O3 and a molecular weight of 270.29 g/mol. Its IUPAC name is N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-phenylacetamide.
| Compound Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 135478301 |
| Molecular Formula | C15H14N2O3 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-[(E)-(2,4-dihydroxyphenyl)methylideneamino]-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C15H14N2O3/c18-13-7-6-12(14(19)9-13)10-16-17-15(20)8-11-4-2-1-3-5-11/h1-7,9-10,18-19H,8H2,(H,17,20)/b16-10+ |
| InChIKey | AJBANBQLDBAWDO-MHWRWJLKSA-N |
| XLogP | 1.79 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|