C17H18N6 — CID 135479920
5-butyl-8-(3-methylphenyl)-1H-[1,2,4]triazolo[5,1-f]purine (PubChem CID 135479920) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is 5-butyl-8-(3-methylphenyl)-1H-[1,2,4]triazolo[5,1-f]purine.
| Compound Name | 5-butyl-8-(3-methylphenyl)-1H-[1,2,4]triazolo[5,1-f]purine |
|---|---|
| PubChem CID | 135479920 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 5-butyl-8-(3-methylphenyl)-1H-[1,2,4]triazolo[5,1-f]purine |
| SMILES | CCCCc1nc2nc[nH]c2c2nc(-c3cccc(C)c3)nn12 |
| InChI | InChI=1S/C17H18N6/c1-3-4-8-13-20-16-14(18-10-19-16)17-21-15(22-23(13)17)12-7-5-6-11(2)9-12/h5-7,9-10H,3-4,8H2,1-2H3,(H,18,19) |
| InChIKey | SSTQNDMKRISULN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |