C12H10N4O2 — CID 135480573
2-amino-7-phenoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one (PubChem CID 135480573) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-amino-7-phenoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one.
| Compound Name | 2-amino-7-phenoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135480573 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-amino-7-phenoxy-3,5-dihydropyrrolo[3,2-d]pyrimidin-4-one |
| SMILES | Nc1nc2c(Oc3ccccc3)c[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C12H10N4O2/c13-12-15-9-8(6-14-10(9)11(17)16-12)18-7-4-2-1-3-5-7/h1-6,14H,(H3,13,15,16,17) |
| InChIKey | NKOQZBQJDRYCNS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 96.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |